About dimethyl-di(propan-2-yl)azanium;triethyl(phenyl)azanium
dimethyl-di(propan-2-yl)azanium;triethyl(phenyl)azanium (PubChem CID 159297233) has the molecular formula C20H40N2+2
and a molecular weight of 308.55 g/mol. Its IUPAC name is dimethyl-di(propan-2-yl)azanium;triethyl(phenyl)azanium.
Molecular Properties
| Compound Name | dimethyl-di(propan-2-yl)azanium;triethyl(phenyl)azanium |
| PubChem CID | 159297233 |
| Molecular Formula | C20H40N2+2 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.32 |
| IUPAC Name | dimethyl-di(propan-2-yl)azanium;triethyl(phenyl)azanium |
| SMILES | CC(C)[N+](C)(C)C(C)C.CC[N+](CC)(CC)c1ccccc1 |
| InChI | InChI=1S/C12H20N.C8H20N/c1-4-13(5-2,6-3)12-10-8-7-9-11-12;1-7(2)9(5,6)8(3)4/h7-11H,4-6H2,1-3H3;7-8H,1-6H3/q2*+1 |
| InChIKey | VBDDNVJNFQFFFM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-di(propan-2-yl)azanium;triethyl(phenyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-di(propan-2-yl)azanium;triethyl(phenyl)azanium?
The IUPAC name of dimethyl-di(propan-2-yl)azanium;triethyl(phenyl)azanium (CID 159297233) is dimethyl-di(propan-2-yl)azanium;triethyl(phenyl)azanium.
What is the SMILES notation for dimethyl-di(propan-2-yl)azanium;triethyl(phenyl)azanium?
The canonical SMILES for dimethyl-di(propan-2-yl)azanium;triethyl(phenyl)azanium is CC(C)[N+](C)(C)C(C)C.CC[N+](CC)(CC)c1ccccc1.
What is the InChIKey of dimethyl-di(propan-2-yl)azanium;triethyl(phenyl)azanium?
The InChIKey is VBDDNVJNFQFFFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N.C8H20N/c1-4-13(5-2,6-3)12-10-8-7-9-11-12;1-7(2)9(5,6)8(3)4/h7-11H,4-6H2,1-3H3;7-8H,1-6H3/q2*+1.
What are the key properties of dimethyl-di(propan-2-yl)azanium;triethyl(phenyl)azanium?
dimethyl-di(propan-2-yl)azanium;triethyl(phenyl)azanium has a molecular weight of 308.55 g/mol, XLogP of 4.93, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-di(propan-2-yl)azanium;triethyl(phenyl)azanium is sourced from PubChem (CID 159297233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).