About ethanolate;trimethyl(phenyl)azanium
ethanolate;trimethyl(phenyl)azanium (PubChem CID 12512092) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is ethanolate;trimethyl(phenyl)azanium.
Molecular Properties
| Compound Name | ethanolate;trimethyl(phenyl)azanium |
| PubChem CID | 12512092 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | ethanolate;trimethyl(phenyl)azanium |
| SMILES | CC[O-].C[N+](C)(C)c1ccccc1 |
| InChI | InChI=1S/C9H14N.C2H5O/c1-10(2,3)9-7-5-4-6-8-9;1-2-3/h4-8H,1-3H3;2H2,1H3/q+1;-1 |
| InChIKey | ZMGDXJGLGYNTSM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze ethanolate;trimethyl(phenyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanolate;trimethyl(phenyl)azanium?
The IUPAC name of ethanolate;trimethyl(phenyl)azanium (CID 12512092) is ethanolate;trimethyl(phenyl)azanium.
What is the SMILES notation for ethanolate;trimethyl(phenyl)azanium?
The canonical SMILES for ethanolate;trimethyl(phenyl)azanium is CC[O-].C[N+](C)(C)c1ccccc1.
What is the InChIKey of ethanolate;trimethyl(phenyl)azanium?
The InChIKey is ZMGDXJGLGYNTSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N.C2H5O/c1-10(2,3)9-7-5-4-6-8-9;1-2-3/h4-8H,1-3H3;2H2,1H3/q+1;-1.
What are the key properties of ethanolate;trimethyl(phenyl)azanium?
ethanolate;trimethyl(phenyl)azanium has a molecular weight of 181.28 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanolate;trimethyl(phenyl)azanium is sourced from PubChem (CID 12512092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).