About azane;trimethyl(phenyl)azanium;hexafluorophosphate
azane;trimethyl(phenyl)azanium;hexafluorophosphate (PubChem CID 175267450) has the molecular formula C9H17F6N2P
and a molecular weight of 298.21 g/mol. Its IUPAC name is azane;trimethyl(phenyl)azanium;hexafluorophosphate.
Molecular Properties
| Compound Name | azane;trimethyl(phenyl)azanium;hexafluorophosphate |
| PubChem CID | 175267450 |
| Molecular Formula | C9H17F6N2P |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | azane;trimethyl(phenyl)azanium;hexafluorophosphate |
| SMILES | C[N+](C)(C)c1ccccc1.F[P-](F)(F)(F)(F)F.N |
| InChI | InChI=1S/C9H14N.F6P.H3N/c1-10(2,3)9-7-5-4-6-8-9;1-7(2,3,4,5)6;/h4-8H,1-3H3;;1H3/q+1;-1; |
| InChIKey | SFUIGFUEUGYESE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze azane;trimethyl(phenyl)azanium;hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;trimethyl(phenyl)azanium;hexafluorophosphate?
The IUPAC name of azane;trimethyl(phenyl)azanium;hexafluorophosphate (CID 175267450) is azane;trimethyl(phenyl)azanium;hexafluorophosphate.
What is the SMILES notation for azane;trimethyl(phenyl)azanium;hexafluorophosphate?
The canonical SMILES for azane;trimethyl(phenyl)azanium;hexafluorophosphate is C[N+](C)(C)c1ccccc1.F[P-](F)(F)(F)(F)F.N.
What is the InChIKey of azane;trimethyl(phenyl)azanium;hexafluorophosphate?
The InChIKey is SFUIGFUEUGYESE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N.F6P.H3N/c1-10(2,3)9-7-5-4-6-8-9;1-7(2,3,4,5)6;/h4-8H,1-3H3;;1H3/q+1;-1;.
What are the key properties of azane;trimethyl(phenyl)azanium;hexafluorophosphate?
azane;trimethyl(phenyl)azanium;hexafluorophosphate has a molecular weight of 298.21 g/mol, XLogP of 5.43, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;trimethyl(phenyl)azanium;hexafluorophosphate is sourced from PubChem (CID 175267450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).