About tetraphenylboranuide;trimethyl(phenyl)azanium
tetraphenylboranuide;trimethyl(phenyl)azanium (PubChem CID 12504234) has the molecular formula C33H34BN
and a molecular weight of 455.45 g/mol. Its IUPAC name is tetraphenylboranuide;trimethyl(phenyl)azanium.
Molecular Properties
| Compound Name | tetraphenylboranuide;trimethyl(phenyl)azanium |
| PubChem CID | 12504234 |
| Molecular Formula | C33H34BN |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | tetraphenylboranuide;trimethyl(phenyl)azanium |
| SMILES | C[N+](C)(C)c1ccccc1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C9H14N/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-10(2,3)9-7-5-4-6-8-9/h1-20H;4-8H,1-3H3/q-1;+1 |
| InChIKey | PUYGJJJFTJBLSV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetraphenylboranuide;trimethyl(phenyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraphenylboranuide;trimethyl(phenyl)azanium?
The IUPAC name of tetraphenylboranuide;trimethyl(phenyl)azanium (CID 12504234) is tetraphenylboranuide;trimethyl(phenyl)azanium.
What is the SMILES notation for tetraphenylboranuide;trimethyl(phenyl)azanium?
The canonical SMILES for tetraphenylboranuide;trimethyl(phenyl)azanium is C[N+](C)(C)c1ccccc1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of tetraphenylboranuide;trimethyl(phenyl)azanium?
The InChIKey is PUYGJJJFTJBLSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20B.C9H14N/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-10(2,3)9-7-5-4-6-8-9/h1-20H;4-8H,1-3H3/q-1;+1.
What are the key properties of tetraphenylboranuide;trimethyl(phenyl)azanium?
tetraphenylboranuide;trimethyl(phenyl)azanium has a molecular weight of 455.45 g/mol, XLogP of 4.95, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetraphenylboranuide;trimethyl(phenyl)azanium is sourced from PubChem (CID 12504234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).