About hydroxyazanium;tetraphenylboranuide
hydroxyazanium;tetraphenylboranuide (PubChem CID 171792531) has the molecular formula C24H24BNO
and a molecular weight of 353.27 g/mol. Its IUPAC name is hydroxyazanium;tetraphenylboranuide.
Molecular Properties
| Compound Name | hydroxyazanium;tetraphenylboranuide |
| PubChem CID | 171792531 |
| Molecular Formula | C24H24BNO |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | hydroxyazanium;tetraphenylboranuide |
| SMILES | [NH3+]O.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.H4NO/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-2/h1-20H;2H,1H3/q-1;+1 |
| InChIKey | HUCNQZNNWHGAPF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydroxyazanium;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxyazanium;tetraphenylboranuide?
The IUPAC name of hydroxyazanium;tetraphenylboranuide (CID 171792531) is hydroxyazanium;tetraphenylboranuide.
What is the SMILES notation for hydroxyazanium;tetraphenylboranuide?
The canonical SMILES for hydroxyazanium;tetraphenylboranuide is [NH3+]O.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of hydroxyazanium;tetraphenylboranuide?
The InChIKey is HUCNQZNNWHGAPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20B.H4NO/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-2/h1-20H;2H,1H3/q-1;+1.
What are the key properties of hydroxyazanium;tetraphenylboranuide?
hydroxyazanium;tetraphenylboranuide has a molecular weight of 353.27 g/mol, XLogP of 1.68, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxyazanium;tetraphenylboranuide is sourced from PubChem (CID 171792531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).