About buta-1,3-diene;rhodium;tetraphenylboranuide
buta-1,3-diene;rhodium;tetraphenylboranuide (PubChem CID 11005281) has the molecular formula C28H26BRh-
and a molecular weight of 476.23 g/mol. Its IUPAC name is buta-1,3-diene;rhodium;tetraphenylboranuide.
Molecular Properties
| Compound Name | buta-1,3-diene;rhodium;tetraphenylboranuide |
| PubChem CID | 11005281 |
| Molecular Formula | C28H26BRh- |
| Molecular Weight | 476.23 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | buta-1,3-diene;rhodium;tetraphenylboranuide |
| SMILES | C=CC=C.[Rh].c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C4H6.Rh/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-3-4-2;/h1-20H;3-4H,1-2H2;/q-1;; |
| InChIKey | JICAGFJQTPDBRD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.23 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-diene;rhodium;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-diene;rhodium;tetraphenylboranuide?
The IUPAC name of buta-1,3-diene;rhodium;tetraphenylboranuide (CID 11005281) is buta-1,3-diene;rhodium;tetraphenylboranuide.
What is the SMILES notation for buta-1,3-diene;rhodium;tetraphenylboranuide?
The canonical SMILES for buta-1,3-diene;rhodium;tetraphenylboranuide is C=CC=C.[Rh].c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of buta-1,3-diene;rhodium;tetraphenylboranuide?
The InChIKey is JICAGFJQTPDBRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20B.C4H6.Rh/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-3-4-2;/h1-20H;3-4H,1-2H2;/q-1;;.
What are the key properties of buta-1,3-diene;rhodium;tetraphenylboranuide?
buta-1,3-diene;rhodium;tetraphenylboranuide has a molecular weight of 476.23 g/mol, XLogP of 4.42, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-diene;rhodium;tetraphenylboranuide is sourced from PubChem (CID 11005281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).