About dimethylphosphanium;tetraphenylboranuide
dimethylphosphanium;tetraphenylboranuide (PubChem CID 174900648) has the molecular formula C26H28BP
and a molecular weight of 382.30 g/mol. Its IUPAC name is dimethylphosphanium;tetraphenylboranuide.
Molecular Properties
| Compound Name | dimethylphosphanium;tetraphenylboranuide |
| PubChem CID | 174900648 |
| Molecular Formula | C26H28BP |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | dimethylphosphanium;tetraphenylboranuide |
| SMILES | C[PH2+]C.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C2H7P/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-3-2/h1-20H;3H,1-2H3/q-1;/p+1 |
| InChIKey | DBQDUQYZOZYCEZ-UHFFFAOYSA-O |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethylphosphanium;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylphosphanium;tetraphenylboranuide?
The IUPAC name of dimethylphosphanium;tetraphenylboranuide (CID 174900648) is dimethylphosphanium;tetraphenylboranuide.
What is the SMILES notation for dimethylphosphanium;tetraphenylboranuide?
The canonical SMILES for dimethylphosphanium;tetraphenylboranuide is C[PH2+]C.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of dimethylphosphanium;tetraphenylboranuide?
The InChIKey is DBQDUQYZOZYCEZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C24H20B.C2H7P/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-3-2/h1-20H;3H,1-2H3/q-1;/p+1.
What are the key properties of dimethylphosphanium;tetraphenylboranuide?
dimethylphosphanium;tetraphenylboranuide has a molecular weight of 382.30 g/mol, XLogP of 3.72, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylphosphanium;tetraphenylboranuide is sourced from PubChem (CID 174900648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).