About ditert-butyl(dimethyl)phosphanium;tetraphenylboranuide
ditert-butyl(dimethyl)phosphanium;tetraphenylboranuide (PubChem CID 163300031) has the molecular formula C34H44BP
and a molecular weight of 494.51 g/mol. Its IUPAC name is ditert-butyl(dimethyl)phosphanium;tetraphenylboranuide.
Molecular Properties
| Compound Name | ditert-butyl(dimethyl)phosphanium;tetraphenylboranuide |
| PubChem CID | 163300031 |
| Molecular Formula | C34H44BP |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.33 |
| IUPAC Name | ditert-butyl(dimethyl)phosphanium;tetraphenylboranuide |
| SMILES | CC(C)(C)[P+](C)(C)C(C)(C)C.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C10H24P/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-9(2,3)11(7,8)10(4,5)6/h1-20H;1-8H3/q-1;+1 |
| InChIKey | DFDXCBCVBYVHRL-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl(dimethyl)phosphanium;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl(dimethyl)phosphanium;tetraphenylboranuide?
The IUPAC name of ditert-butyl(dimethyl)phosphanium;tetraphenylboranuide (CID 163300031) is ditert-butyl(dimethyl)phosphanium;tetraphenylboranuide.
What is the SMILES notation for ditert-butyl(dimethyl)phosphanium;tetraphenylboranuide?
The canonical SMILES for ditert-butyl(dimethyl)phosphanium;tetraphenylboranuide is CC(C)(C)[P+](C)(C)C(C)(C)C.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of ditert-butyl(dimethyl)phosphanium;tetraphenylboranuide?
The InChIKey is DFDXCBCVBYVHRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20B.C10H24P/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-9(2,3)11(7,8)10(4,5)6/h1-20H;1-8H3/q-1;+1.
What are the key properties of ditert-butyl(dimethyl)phosphanium;tetraphenylboranuide?
ditert-butyl(dimethyl)phosphanium;tetraphenylboranuide has a molecular weight of 494.51 g/mol, XLogP of 6.92, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl(dimethyl)phosphanium;tetraphenylboranuide is sourced from PubChem (CID 163300031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).