About methanamine;tetraphenylboranuide
methanamine;tetraphenylboranuide (PubChem CID 175835863) has the molecular formula C25H25BN-
and a molecular weight of 350.29 g/mol. Its IUPAC name is methanamine;tetraphenylboranuide.
Molecular Properties
| Compound Name | methanamine;tetraphenylboranuide |
| PubChem CID | 175835863 |
| Molecular Formula | C25H25BN- |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | methanamine;tetraphenylboranuide |
| SMILES | CN.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.CH5N/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-2/h1-20H;2H2,1H3/q-1; |
| InChIKey | MSBDPWQTTBIOFY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methanamine;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;tetraphenylboranuide?
The IUPAC name of methanamine;tetraphenylboranuide (CID 175835863) is methanamine;tetraphenylboranuide.
What is the SMILES notation for methanamine;tetraphenylboranuide?
The canonical SMILES for methanamine;tetraphenylboranuide is CN.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of methanamine;tetraphenylboranuide?
The InChIKey is MSBDPWQTTBIOFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20B.CH5N/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-2/h1-20H;2H2,1H3/q-1;.
What are the key properties of methanamine;tetraphenylboranuide?
methanamine;tetraphenylboranuide has a molecular weight of 350.29 g/mol, XLogP of 2.64, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;tetraphenylboranuide is sourced from PubChem (CID 175835863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).