C30H30O7P2 — CID 172800444
bis(diphenylphosphane);2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 172800444) has the molecular formula C30H30O7P2 and a molecular weight of 564.51 g/mol. Its IUPAC name is bis(diphenylphosphane);2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | bis(diphenylphosphane);2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 172800444 |
| Molecular Formula | C30H30O7P2 |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | bis(diphenylphosphane);2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.c1ccc(Pc2ccccc2)cc1.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/2C12H11P.C6H8O7/c2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;7-3(8)1-6(13,5(11)12)2-4(9)10/h2*1-10,13H;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | QUDRRYHKFMDSJL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|