C13H13NO7 — CID 161357104
benzonitrile;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 161357104) has the molecular formula C13H13NO7 and a molecular weight of 295.25 g/mol. Its IUPAC name is benzonitrile;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | benzonitrile;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 161357104 |
| Molecular Formula | C13H13NO7 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | benzonitrile;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | N#Cc1ccccc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H5N.C6H8O7/c8-6-7-4-2-1-3-5-7;7-3(8)1-6(13,5(11)12)2-4(9)10/h1-5H;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | VORORNSITUBPGG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |