C29H32N2O3 — CID 139194947
[(1S,2S)-2-amino-1,2-diphenylethyl]azanium;methanol;2-(4-phenylphenyl)acetate (PubChem CID 139194947) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is [(1S,2S)-2-amino-1,2-diphenylethyl]azanium;methanol;2-(4-phenylphenyl)acetate.
| Compound Name | [(1S,2S)-2-amino-1,2-diphenylethyl]azanium;methanol;2-(4-phenylphenyl)acetate |
|---|---|
| PubChem CID | 139194947 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | [(1S,2S)-2-amino-1,2-diphenylethyl]azanium;methanol;2-(4-phenylphenyl)acetate |
| SMILES | CO.N[C@@H](c1ccccc1)[C@@H]([NH3+])c1ccccc1.O=C([O-])Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H16N2.C14H12O2.CH4O/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;1-2/h1-10,13-14H,15-16H2;1-9H,10H2,(H,15,16);2H,1H3/t13-,14-;;/m0../s1 |
| InChIKey | YQSFTQIQIGMJPV-AXEKQOJOSA-N |
| XLogP | 2.92 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |