About triethyl(2-hydroxypropyl)azanium;benzoate;hydrochloride
triethyl(2-hydroxypropyl)azanium;benzoate;hydrochloride (PubChem CID 20833865) has the molecular formula C16H28ClNO3
and a molecular weight of 317.86 g/mol. Its IUPAC name is triethyl(2-hydroxypropyl)azanium;benzoate;hydrochloride.
Molecular Properties
| Compound Name | triethyl(2-hydroxypropyl)azanium;benzoate;hydrochloride |
| PubChem CID | 20833865 |
| Molecular Formula | C16H28ClNO3 |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | triethyl(2-hydroxypropyl)azanium;benzoate;hydrochloride |
| SMILES | CC[N+](CC)(CC)CC(C)O.Cl.O=C([O-])c1ccccc1 |
| InChI | InChI=1S/C9H22NO.C7H6O2.ClH/c1-5-10(6-2,7-3)8-9(4)11;8-7(9)6-4-2-1-3-5-6;/h9,11H,5-8H2,1-4H3;1-5H,(H,8,9);1H/q+1;;/p-1 |
| InChIKey | ZSROSZPQZYZJDY-UHFFFAOYSA-M |
| XLogP | 1.72 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triethyl(2-hydroxypropyl)azanium;benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl(2-hydroxypropyl)azanium;benzoate;hydrochloride?
The IUPAC name of triethyl(2-hydroxypropyl)azanium;benzoate;hydrochloride (CID 20833865) is triethyl(2-hydroxypropyl)azanium;benzoate;hydrochloride.
What is the SMILES notation for triethyl(2-hydroxypropyl)azanium;benzoate;hydrochloride?
The canonical SMILES for triethyl(2-hydroxypropyl)azanium;benzoate;hydrochloride is CC[N+](CC)(CC)CC(C)O.Cl.O=C([O-])c1ccccc1.
What is the InChIKey of triethyl(2-hydroxypropyl)azanium;benzoate;hydrochloride?
The InChIKey is ZSROSZPQZYZJDY-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H22NO.C7H6O2.ClH/c1-5-10(6-2,7-3)8-9(4)11;8-7(9)6-4-2-1-3-5-6;/h9,11H,5-8H2,1-4H3;1-5H,(H,8,9);1H/q+1;;/p-1.
What are the key properties of triethyl(2-hydroxypropyl)azanium;benzoate;hydrochloride?
triethyl(2-hydroxypropyl)azanium;benzoate;hydrochloride has a molecular weight of 317.86 g/mol, XLogP of 1.72, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl(2-hydroxypropyl)azanium;benzoate;hydrochloride is sourced from PubChem (CID 20833865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).