About sodium;N,N-difluoroaniline;acetate
sodium;N,N-difluoroaniline;acetate (PubChem CID 162315438) has the molecular formula C8H8F2NNaO2
and a molecular weight of 211.14 g/mol. Its IUPAC name is sodium;N,N-difluoroaniline;acetate.
Molecular Properties
| Compound Name | sodium;N,N-difluoroaniline;acetate |
| PubChem CID | 162315438 |
| Molecular Formula | C8H8F2NNaO2 |
| Molecular Weight | 211.14 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | sodium;N,N-difluoroaniline;acetate |
| SMILES | CC(=O)[O-].FN(F)c1ccccc1.[Na+] |
| InChI | InChI=1S/C6H5F2N.C2H4O2.Na/c7-9(8)6-4-2-1-3-5-6;1-2(3)4;/h1-5H;1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | HFSARFCMCMIZKY-UHFFFAOYSA-M |
| XLogP | -1.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.14 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze sodium;N,N-difluoroaniline;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;N,N-difluoroaniline;acetate?
The IUPAC name of sodium;N,N-difluoroaniline;acetate (CID 162315438) is sodium;N,N-difluoroaniline;acetate.
What is the SMILES notation for sodium;N,N-difluoroaniline;acetate?
The canonical SMILES for sodium;N,N-difluoroaniline;acetate is CC(=O)[O-].FN(F)c1ccccc1.[Na+].
What is the InChIKey of sodium;N,N-difluoroaniline;acetate?
The InChIKey is HFSARFCMCMIZKY-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5F2N.C2H4O2.Na/c7-9(8)6-4-2-1-3-5-6;1-2(3)4;/h1-5H;1H3,(H,3,4);/q;;+1/p-1.
What are the key properties of sodium;N,N-difluoroaniline;acetate?
sodium;N,N-difluoroaniline;acetate has a molecular weight of 211.14 g/mol, XLogP of -1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;N,N-difluoroaniline;acetate is sourced from PubChem (CID 162315438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).