About 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine acetate
1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine acetate (PubChem CID 153327151) has the molecular formula C29H32N2O2
and a molecular weight of 440.59 g/mol. Its IUPAC name is 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine acetate.
Molecular Properties
| Compound Name | 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine acetate |
| PubChem CID | 153327151 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine acetate |
| SMILES | CC(=O)[O-].c1ccc(N(c2ccccc2)c2cc[n+](C34CC5CC(CC(C5)C3)C4)cc2)cc1 |
| InChI | InChI=1S/C27H29N2.C2H4O2/c1-3-7-24(8-4-1)29(25-9-5-2-6-10-25)26-11-13-28(14-12-26)27-18-21-15-22(19-27)17-23(16-21)20-27;1-2(3)4/h1-14,21-23H,15-20H2;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | ISVMNLBOBDWCEN-UHFFFAOYSA-M |
| XLogP | 5.13 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine acetate?
The IUPAC name of 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine acetate (CID 153327151) is 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine acetate.
What is the SMILES notation for 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine acetate?
The canonical SMILES for 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine acetate is CC(=O)[O-].c1ccc(N(c2ccccc2)c2cc[n+](C34CC5CC(CC(C5)C3)C4)cc2)cc1.
What is the InChIKey of 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine acetate?
The InChIKey is ISVMNLBOBDWCEN-UHFFFAOYSA-M. The full InChI is InChI=1S/C27H29N2.C2H4O2/c1-3-7-24(8-4-1)29(25-9-5-2-6-10-25)26-11-13-28(14-12-26)27-18-21-15-22(19-27)17-23(16-21)20-27;1-2(3)4/h1-14,21-23H,15-20H2;1H3,(H,3,4)/q+1;/p-1.
What are the key properties of 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine acetate?
1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine acetate has a molecular weight of 440.59 g/mol, XLogP of 5.13, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine acetate is sourced from PubChem (CID 153327151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).