C27H29ClN2 — CID 153327233
1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride (PubChem CID 153327233) has the molecular formula C27H29ClN2 and a molecular weight of 417.00 g/mol. Its IUPAC name is 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride.
| Compound Name | 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride |
|---|---|
| PubChem CID | 153327233 |
| Molecular Formula | C27H29ClN2 |
| Molecular Weight | 417.00 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride |
| SMILES | [Cl-].c1ccc(N(c2ccccc2)c2cc[n+](C34CC5CC(CC(C5)C3)C4)cc2)cc1 |
| InChI | InChI=1S/C27H29N2.ClH/c1-3-7-24(8-4-1)29(25-9-5-2-6-10-25)26-11-13-28(14-12-26)27-18-21-15-22(19-27)17-23(16-21)20-27;/h1-14,21-23H,15-20H2;1H/q+1;/p-1 |
| InChIKey | DVJQGOGSVOQIFF-UHFFFAOYSA-M |
| XLogP | 3.37 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.00 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|