About 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride
1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride (PubChem CID 153327233) has the molecular formula C27H29ClN2
and a molecular weight of 417.00 g/mol. Its IUPAC name is 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride.
Molecular Properties
| Compound Name | 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride |
| PubChem CID | 153327233 |
| Molecular Formula | C27H29ClN2 |
| Molecular Weight | 417.00 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride |
| SMILES | [Cl-].c1ccc(N(c2ccccc2)c2cc[n+](C34CC5CC(CC(C5)C3)C4)cc2)cc1 |
| InChI | InChI=1S/C27H29N2.ClH/c1-3-7-24(8-4-1)29(25-9-5-2-6-10-25)26-11-13-28(14-12-26)27-18-21-15-22(19-27)17-23(16-21)20-27;/h1-14,21-23H,15-20H2;1H/q+1;/p-1 |
| InChIKey | DVJQGOGSVOQIFF-UHFFFAOYSA-M |
| XLogP | 3.37 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.00 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride?
The IUPAC name of 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride (CID 153327233) is 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride.
What is the SMILES notation for 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride?
The canonical SMILES for 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride is [Cl-].c1ccc(N(c2ccccc2)c2cc[n+](C34CC5CC(CC(C5)C3)C4)cc2)cc1.
What is the InChIKey of 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride?
The InChIKey is DVJQGOGSVOQIFF-UHFFFAOYSA-M. The full InChI is InChI=1S/C27H29N2.ClH/c1-3-7-24(8-4-1)29(25-9-5-2-6-10-25)26-11-13-28(14-12-26)27-18-21-15-22(19-27)17-23(16-21)20-27;/h1-14,21-23H,15-20H2;1H/q+1;/p-1.
What are the key properties of 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride?
1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride has a molecular weight of 417.00 g/mol, XLogP of 3.37, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)-N,N-diphenylpyridin-1-ium-4-amine chloride is sourced from PubChem (CID 153327233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).