C29H34N2O3S — CID 153327193
1-(1-adamantyl)-N-methyl-N-(4-methylphenyl)pyridin-1-ium-4-amine;benzenesulfonate (PubChem CID 153327193) has the molecular formula C29H34N2O3S and a molecular weight of 490.67 g/mol. Its IUPAC name is 1-(1-adamantyl)-N-methyl-N-(4-methylphenyl)pyridin-1-ium-4-amine;benzenesulfonate.
| Compound Name | 1-(1-adamantyl)-N-methyl-N-(4-methylphenyl)pyridin-1-ium-4-amine;benzenesulfonate |
|---|---|
| PubChem CID | 153327193 |
| Molecular Formula | C29H34N2O3S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 1-(1-adamantyl)-N-methyl-N-(4-methylphenyl)pyridin-1-ium-4-amine;benzenesulfonate |
| SMILES | Cc1ccc(N(C)c2cc[n+](C34CC5CC(CC(C5)C3)C4)cc2)cc1.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C23H29N2.C6H6O3S/c1-17-3-5-21(6-4-17)24(2)22-7-9-25(10-8-22)23-14-18-11-19(15-23)13-20(12-18)16-23;7-10(8,9)6-4-2-1-3-5-6/h3-10,18-20H,11-16H2,1-2H3;1-5H,(H,7,8,9)/q+1;/p-1 |
| InChIKey | HTTWMROOLQWSSS-UHFFFAOYSA-M |
| XLogP | 5.57 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|