C18H25NO2S — CID 22204446
N-(1-adamantyl)-N,4-dimethylbenzenesulfonamide (PubChem CID 22204446) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is N-(1-adamantyl)-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-(1-adamantyl)-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 22204446 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-(1-adamantyl)-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C18H25NO2S/c1-13-3-5-17(6-4-13)22(20,21)19(2)18-10-14-7-15(11-18)9-16(8-14)12-18/h3-6,14-16H,7-12H2,1-2H3 |
| InChIKey | OZBVDDOIQWJKBX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |