C18H27NO3S — CID 101480012
N-[(1R,3R,4S,6S)-4-hydroxy-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 101480012) has the molecular formula C18H27NO3S and a molecular weight of 337.49 g/mol. Its IUPAC name is N-[(1R,3R,4S,6S)-4-hydroxy-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[(1R,3R,4S,6S)-4-hydroxy-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 101480012 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | N-[(1R,3R,4S,6S)-4-hydroxy-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)[C@@H]2C[C@@H]3[C@H](C[C@]2(C)O)C3(C)C)cc1 |
| InChI | InChI=1S/C18H27NO3S/c1-12-6-8-13(9-7-12)23(21,22)19(5)16-10-14-15(17(14,2)3)11-18(16,4)20/h6-9,14-16,20H,10-11H2,1-5H3/t14-,15+,16-,18+/m1/s1 |
| InChIKey | FRBAEHCSIQSFLI-HPFXQQBRSA-N |
| XLogP | 2.80 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |