C13H18ClNO3S — CID 122209577
N-[(2S,3R)-2-chlorooxan-3-yl]-N,4-dimethylbenzenesulfonamide (PubChem CID 122209577) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is N-[(2S,3R)-2-chlorooxan-3-yl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[(2S,3R)-2-chlorooxan-3-yl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 122209577 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | N-[(2S,3R)-2-chlorooxan-3-yl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)[C@@H]2CCCO[C@H]2Cl)cc1 |
| InChI | InChI=1S/C13H18ClNO3S/c1-10-5-7-11(8-6-10)19(16,17)15(2)12-4-3-9-18-13(12)14/h5-8,12-13H,3-4,9H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | LWRKBEJKVCYGQO-CHWSQXEVSA-N |
| XLogP | 2.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|