C16H22ClNO2S — CID 122209576
N-[(3Z)-5-chlorocyclooct-3-en-1-yl]-N,4-dimethylbenzenesulfonamide (PubChem CID 122209576) has the molecular formula C16H22ClNO2S and a molecular weight of 327.88 g/mol. Its IUPAC name is N-[(3Z)-5-chlorocyclooct-3-en-1-yl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[(3Z)-5-chlorocyclooct-3-en-1-yl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 122209576 |
| Molecular Formula | C16H22ClNO2S |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-[(3Z)-5-chlorocyclooct-3-en-1-yl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C2C/C=C\C(Cl)CCC2)cc1 |
| InChI | InChI=1S/C16H22ClNO2S/c1-13-9-11-16(12-10-13)21(19,20)18(2)15-7-3-5-14(17)6-4-8-15/h3,5,9-12,14-15H,4,6-8H2,1-2H3/b5-3- |
| InChIKey | AXBMXMBGXOPWHK-HYXAFXHYSA-N |
| XLogP | 3.72 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|