C14H11NaOS — CID 88787472
sodium 2,2-diphenylethanethioate (PubChem CID 88787472) has the molecular formula C14H11NaOS and a molecular weight of 250.30 g/mol. Its IUPAC name is sodium 2,2-diphenylethanethioate.
| Compound Name | sodium 2,2-diphenylethanethioate |
|---|---|
| PubChem CID | 88787472 |
| Molecular Formula | C14H11NaOS |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | sodium 2,2-diphenylethanethioate |
| SMILES | [Na+].[O-]C(=S)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12OS.Na/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10,13H,(H,15,16);/q;+1/p-1 |
| InChIKey | UAWSQDMOSLSOTR-UHFFFAOYSA-M |
| XLogP | -0.49 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|