C15H20 — CID 144969758
[(3E)-3-tert-butylpenta-1,3-dienyl]benzene (PubChem CID 144969758) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is [(3E)-3-tert-butylpenta-1,3-dienyl]benzene.
| Compound Name | [(3E)-3-tert-butylpenta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 144969758 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | [(3E)-3-tert-butylpenta-1,3-dienyl]benzene |
| SMILES | C/C=C(\C=Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C15H20/c1-5-14(15(2,3)4)12-11-13-9-7-6-8-10-13/h5-12H,1-4H3/b12-11?,14-5+ |
| InChIKey | SPXMNBPABQGZDL-INIMAIMYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|