C21H22ClN — CID 11723731
(2E,4E)-3-tert-butyl-N-(4-chlorophenyl)-5-phenylpenta-2,4-dien-1-imine (PubChem CID 11723731) has the molecular formula C21H22ClN and a molecular weight of 323.87 g/mol. Its IUPAC name is (2E,4E)-3-tert-butyl-N-(4-chlorophenyl)-5-phenylpenta-2,4-dien-1-imine.
| Compound Name | (2E,4E)-3-tert-butyl-N-(4-chlorophenyl)-5-phenylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 11723731 |
| Molecular Formula | C21H22ClN |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (2E,4E)-3-tert-butyl-N-(4-chlorophenyl)-5-phenylpenta-2,4-dien-1-imine |
| SMILES | CC(C)(C)C(/C=C/c1ccccc1)=C/C=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClN/c1-21(2,3)18(10-9-17-7-5-4-6-8-17)15-16-23-20-13-11-19(22)12-14-20/h4-16H,1-3H3/b10-9+,18-15+,23-16+ |
| InChIKey | PWHMXWNDNRHSDF-MJEVZTCYSA-N |
| XLogP | 6.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|