C14H18IN — CID 161303073
(E)-5-iodo-N,4,4-trimethyl-1-phenylpent-1-en-3-imine (PubChem CID 161303073) has the molecular formula C14H18IN and a molecular weight of 327.21 g/mol. Its IUPAC name is (E)-5-iodo-N,4,4-trimethyl-1-phenylpent-1-en-3-imine.
| Compound Name | (E)-5-iodo-N,4,4-trimethyl-1-phenylpent-1-en-3-imine |
|---|---|
| PubChem CID | 161303073 |
| Molecular Formula | C14H18IN |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | (E)-5-iodo-N,4,4-trimethyl-1-phenylpent-1-en-3-imine |
| SMILES | C/N=C(/C=C/c1ccccc1)C(C)(C)CI |
| InChI | InChI=1S/C14H18IN/c1-14(2,11-15)13(16-3)10-9-12-7-5-4-6-8-12/h4-10H,11H2,1-3H3/b10-9+,16-13- |
| InChIKey | ZSFGHNBVSRPQHJ-ZDHWLGKOSA-N |
| XLogP | 4.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|