About 2-[2-(3-phenylprop-2-enoyloxy)propan-2-yldiazenyl]propan-2-yl 3-phenylprop-2-enoate
2-[2-(3-phenylprop-2-enoyloxy)propan-2-yldiazenyl]propan-2-yl 3-phenylprop-2-enoate (PubChem CID 139630857) has the molecular formula C24H26N2O4
and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-[2-(3-phenylprop-2-enoyloxy)propan-2-yldiazenyl]propan-2-yl 3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | 2-[2-(3-phenylprop-2-enoyloxy)propan-2-yldiazenyl]propan-2-yl 3-phenylprop-2-enoate |
| PubChem CID | 139630857 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 2-[2-(3-phenylprop-2-enoyloxy)propan-2-yldiazenyl]propan-2-yl 3-phenylprop-2-enoate |
| SMILES | CC(C)(N=NC(C)(C)OC(=O)C=Cc1ccccc1)OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C24H26N2O4/c1-23(2,29-21(27)17-15-19-11-7-5-8-12-19)25-26-24(3,4)30-22(28)18-16-20-13-9-6-10-14-20/h5-18H,1-4H3 |
| InChIKey | LJGATPMHFGLPKR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(3-phenylprop-2-enoyloxy)propan-2-yldiazenyl]propan-2-yl 3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3-phenylprop-2-enoyloxy)propan-2-yldiazenyl]propan-2-yl 3-phenylprop-2-enoate?
The IUPAC name of 2-[2-(3-phenylprop-2-enoyloxy)propan-2-yldiazenyl]propan-2-yl 3-phenylprop-2-enoate (CID 139630857) is 2-[2-(3-phenylprop-2-enoyloxy)propan-2-yldiazenyl]propan-2-yl 3-phenylprop-2-enoate.
What is the SMILES notation for 2-[2-(3-phenylprop-2-enoyloxy)propan-2-yldiazenyl]propan-2-yl 3-phenylprop-2-enoate?
The canonical SMILES for 2-[2-(3-phenylprop-2-enoyloxy)propan-2-yldiazenyl]propan-2-yl 3-phenylprop-2-enoate is CC(C)(N=NC(C)(C)OC(=O)C=Cc1ccccc1)OC(=O)C=Cc1ccccc1.
What is the InChIKey of 2-[2-(3-phenylprop-2-enoyloxy)propan-2-yldiazenyl]propan-2-yl 3-phenylprop-2-enoate?
The InChIKey is LJGATPMHFGLPKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N2O4/c1-23(2,29-21(27)17-15-19-11-7-5-8-12-19)25-26-24(3,4)30-22(28)18-16-20-13-9-6-10-14-20/h5-18H,1-4H3.
What are the key properties of 2-[2-(3-phenylprop-2-enoyloxy)propan-2-yldiazenyl]propan-2-yl 3-phenylprop-2-enoate?
2-[2-(3-phenylprop-2-enoyloxy)propan-2-yldiazenyl]propan-2-yl 3-phenylprop-2-enoate has a molecular weight of 406.48 g/mol, XLogP of 5.42, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-phenylprop-2-enoyloxy)propan-2-yldiazenyl]propan-2-yl 3-phenylprop-2-enoate is sourced from PubChem (CID 139630857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).