C24H20O4 — CID 75086298
(2-methoxy-2-oxo-1,1-diphenylethyl) 3-phenylprop-2-enoate (PubChem CID 75086298) has the molecular formula C24H20O4 and a molecular weight of 372.42 g/mol. Its IUPAC name is (2-methoxy-2-oxo-1,1-diphenylethyl) 3-phenylprop-2-enoate.
| Compound Name | (2-methoxy-2-oxo-1,1-diphenylethyl) 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 75086298 |
| Molecular Formula | C24H20O4 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (2-methoxy-2-oxo-1,1-diphenylethyl) 3-phenylprop-2-enoate |
| SMILES | COC(=O)C(OC(=O)C=Cc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20O4/c1-27-23(26)24(20-13-7-3-8-14-20,21-15-9-4-10-16-21)28-22(25)18-17-19-11-5-2-6-12-19/h2-18H,1H3 |
| InChIKey | WGMQBFXJJKILCT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|