About (E)-N'-(4-chlorophenyl)-3-[4-(4-phenylpiperazin-1-yl)phenyl]prop-2-enimidamide
(E)-N'-(4-chlorophenyl)-3-[4-(4-phenylpiperazin-1-yl)phenyl]prop-2-enimidamide (PubChem CID 59789896) has the molecular formula C25H25ClN4
and a molecular weight of 416.96 g/mol. Its IUPAC name is (E)-N'-(4-chlorophenyl)-3-[4-(4-phenylpiperazin-1-yl)phenyl]prop-2-enimidamide.
Molecular Properties
| Compound Name | (E)-N'-(4-chlorophenyl)-3-[4-(4-phenylpiperazin-1-yl)phenyl]prop-2-enimidamide |
| PubChem CID | 59789896 |
| Molecular Formula | C25H25ClN4 |
| Molecular Weight | 416.96 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (E)-N'-(4-chlorophenyl)-3-[4-(4-phenylpiperazin-1-yl)phenyl]prop-2-enimidamide |
| SMILES | NC(/C=C/c1ccc(N2CCN(c3ccccc3)CC2)cc1)=N\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H25ClN4/c26-21-9-11-22(12-10-21)28-25(27)15-8-20-6-13-24(14-7-20)30-18-16-29(17-19-30)23-4-2-1-3-5-23/h1-15H,16-19H2,(H2,27,28)/b15-8+ |
| InChIKey | MMPNLNKSSLNDFE-OVCLIPMQSA-N |
| XLogP | 5.37 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.96 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-(4-chlorophenyl)-3-[4-(4-phenylpiperazin-1-yl)phenyl]prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-(4-chlorophenyl)-3-[4-(4-phenylpiperazin-1-yl)phenyl]prop-2-enimidamide?
The IUPAC name of (E)-N'-(4-chlorophenyl)-3-[4-(4-phenylpiperazin-1-yl)phenyl]prop-2-enimidamide (CID 59789896) is (E)-N'-(4-chlorophenyl)-3-[4-(4-phenylpiperazin-1-yl)phenyl]prop-2-enimidamide.
What is the SMILES notation for (E)-N'-(4-chlorophenyl)-3-[4-(4-phenylpiperazin-1-yl)phenyl]prop-2-enimidamide?
The canonical SMILES for (E)-N'-(4-chlorophenyl)-3-[4-(4-phenylpiperazin-1-yl)phenyl]prop-2-enimidamide is NC(/C=C/c1ccc(N2CCN(c3ccccc3)CC2)cc1)=N\c1ccc(Cl)cc1.
What is the InChIKey of (E)-N'-(4-chlorophenyl)-3-[4-(4-phenylpiperazin-1-yl)phenyl]prop-2-enimidamide?
The InChIKey is MMPNLNKSSLNDFE-OVCLIPMQSA-N. The full InChI is InChI=1S/C25H25ClN4/c26-21-9-11-22(12-10-21)28-25(27)15-8-20-6-13-24(14-7-20)30-18-16-29(17-19-30)23-4-2-1-3-5-23/h1-15H,16-19H2,(H2,27,28)/b15-8+.
What are the key properties of (E)-N'-(4-chlorophenyl)-3-[4-(4-phenylpiperazin-1-yl)phenyl]prop-2-enimidamide?
(E)-N'-(4-chlorophenyl)-3-[4-(4-phenylpiperazin-1-yl)phenyl]prop-2-enimidamide has a molecular weight of 416.96 g/mol, XLogP of 5.37, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-(4-chlorophenyl)-3-[4-(4-phenylpiperazin-1-yl)phenyl]prop-2-enimidamide is sourced from PubChem (CID 59789896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).