C23H21ClN2O2 — CID 72562744
N'-(4-chlorophenyl)-3-[4-(3,4-dimethoxyphenyl)phenyl]prop-2-enimidamide (PubChem CID 72562744) has the molecular formula C23H21ClN2O2 and a molecular weight of 392.89 g/mol. Its IUPAC name is N'-(4-chlorophenyl)-3-[4-(3,4-dimethoxyphenyl)phenyl]prop-2-enimidamide.
| Compound Name | N'-(4-chlorophenyl)-3-[4-(3,4-dimethoxyphenyl)phenyl]prop-2-enimidamide |
|---|---|
| PubChem CID | 72562744 |
| Molecular Formula | C23H21ClN2O2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N'-(4-chlorophenyl)-3-[4-(3,4-dimethoxyphenyl)phenyl]prop-2-enimidamide |
| SMILES | COc1ccc(-c2ccc(C=C/C(N)=N/c3ccc(Cl)cc3)cc2)cc1OC |
| InChI | InChI=1S/C23H21ClN2O2/c1-27-21-13-8-18(15-22(21)28-2)17-6-3-16(4-7-17)5-14-23(25)26-20-11-9-19(24)10-12-20/h3-15H,1-2H3,(H2,25,26) |
| InChIKey | PPCWAWDWLKDAMT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|