About (E)-3-(4-chlorophenyl)-N'-hydroxyprop-2-enimidamide;hydrate
(E)-3-(4-chlorophenyl)-N'-hydroxyprop-2-enimidamide;hydrate (PubChem CID 173457172) has the molecular formula C9H11ClN2O2
and a molecular weight of 214.65 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N'-hydroxyprop-2-enimidamide;hydrate.
Molecular Properties
| Compound Name | (E)-3-(4-chlorophenyl)-N'-hydroxyprop-2-enimidamide;hydrate |
| PubChem CID | 173457172 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N'-hydroxyprop-2-enimidamide;hydrate |
| SMILES | NC(/C=C/c1ccc(Cl)cc1)=NO.O |
| InChI | InChI=1S/C9H9ClN2O.H2O/c10-8-4-1-7(2-5-8)3-6-9(11)12-13;/h1-6,13H,(H2,11,12);1H2/b6-3+; |
| InChIKey | MYBXSLSBNRKKIE-ZIKNSQGESA-N |
| XLogP | 1.27 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(4-chlorophenyl)-N'-hydroxyprop-2-enimidamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(4-chlorophenyl)-N'-hydroxyprop-2-enimidamide;hydrate?
The IUPAC name of (E)-3-(4-chlorophenyl)-N'-hydroxyprop-2-enimidamide;hydrate (CID 173457172) is (E)-3-(4-chlorophenyl)-N'-hydroxyprop-2-enimidamide;hydrate.
What is the SMILES notation for (E)-3-(4-chlorophenyl)-N'-hydroxyprop-2-enimidamide;hydrate?
The canonical SMILES for (E)-3-(4-chlorophenyl)-N'-hydroxyprop-2-enimidamide;hydrate is NC(/C=C/c1ccc(Cl)cc1)=NO.O.
What is the InChIKey of (E)-3-(4-chlorophenyl)-N'-hydroxyprop-2-enimidamide;hydrate?
The InChIKey is MYBXSLSBNRKKIE-ZIKNSQGESA-N. The full InChI is InChI=1S/C9H9ClN2O.H2O/c10-8-4-1-7(2-5-8)3-6-9(11)12-13;/h1-6,13H,(H2,11,12);1H2/b6-3+;.
What are the key properties of (E)-3-(4-chlorophenyl)-N'-hydroxyprop-2-enimidamide;hydrate?
(E)-3-(4-chlorophenyl)-N'-hydroxyprop-2-enimidamide;hydrate has a molecular weight of 214.65 g/mol, XLogP of 1.27, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(4-chlorophenyl)-N'-hydroxyprop-2-enimidamide;hydrate is sourced from PubChem (CID 173457172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).