C18H20ClN3 — CID 143072549
(E)-N'-(4-chlorophenyl)-3-[4-[ethyl(methyl)amino]phenyl]prop-2-enimidamide (PubChem CID 143072549) has the molecular formula C18H20ClN3 and a molecular weight of 313.83 g/mol. Its IUPAC name is (E)-N'-(4-chlorophenyl)-3-[4-[ethyl(methyl)amino]phenyl]prop-2-enimidamide.
| Compound Name | (E)-N'-(4-chlorophenyl)-3-[4-[ethyl(methyl)amino]phenyl]prop-2-enimidamide |
|---|---|
| PubChem CID | 143072549 |
| Molecular Formula | C18H20ClN3 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (E)-N'-(4-chlorophenyl)-3-[4-[ethyl(methyl)amino]phenyl]prop-2-enimidamide |
| SMILES | CCN(C)c1ccc(/C=C/C(N)=N/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H20ClN3/c1-3-22(2)17-11-4-14(5-12-17)6-13-18(20)21-16-9-7-15(19)8-10-16/h4-13H,3H2,1-2H3,(H2,20,21)/b13-6+ |
| InChIKey | MYOQVOLNEWDNHJ-AWNIVKPZSA-N |
| XLogP | 4.50 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|