C40H38ClN3O2 — CID 159267878
1-(4-chlorophenyl)-5-[4-[ethyl(methyl)amino]phenyl]penta-1,4-dien-3-one;4-[5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzonitrile (PubChem CID 159267878) has the molecular formula C40H38ClN3O2 and a molecular weight of 628.22 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[4-[ethyl(methyl)amino]phenyl]penta-1,4-dien-3-one;4-[5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzonitrile.
| Compound Name | 1-(4-chlorophenyl)-5-[4-[ethyl(methyl)amino]phenyl]penta-1,4-dien-3-one;4-[5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzonitrile |
|---|---|
| PubChem CID | 159267878 |
| Molecular Formula | C40H38ClN3O2 |
| Molecular Weight | 628.22 g/mol |
| Exact Mass | 627.27 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[4-[ethyl(methyl)amino]phenyl]penta-1,4-dien-3-one;4-[5-[4-(dimethylamino)phenyl]-3-oxopenta-1,4-dienyl]benzonitrile |
| SMILES | CCN(C)c1ccc(C=CC(=O)C=Cc2ccc(Cl)cc2)cc1.CN(C)c1ccc(C=CC(=O)C=Cc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C20H20ClNO.C20H18N2O/c1-3-22(2)19-12-6-17(7-13-19)9-15-20(23)14-8-16-4-10-18(21)11-5-16;1-22(2)19-11-7-17(8-12-19)10-14-20(23)13-9-16-3-5-18(15-21)6-4-16/h4-15H,3H2,1-2H3;3-14H,1-2H3 |
| InChIKey | KXIHEFWSGUVLTE-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.22 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|