C20H19ClO4 — CID 88638678
(3Z,5E)-6-(4-chlorophenyl)-4-(3,4-dimethoxyphenyl)hexa-3,5-dienoic acid (PubChem CID 88638678) has the molecular formula C20H19ClO4 and a molecular weight of 358.82 g/mol. Its IUPAC name is (3Z,5E)-6-(4-chlorophenyl)-4-(3,4-dimethoxyphenyl)hexa-3,5-dienoic acid.
| Compound Name | (3Z,5E)-6-(4-chlorophenyl)-4-(3,4-dimethoxyphenyl)hexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 88638678 |
| Molecular Formula | C20H19ClO4 |
| Molecular Weight | 358.82 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (3Z,5E)-6-(4-chlorophenyl)-4-(3,4-dimethoxyphenyl)hexa-3,5-dienoic acid |
| SMILES | COc1ccc(C(=C\CC(=O)O)/C=C/c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C20H19ClO4/c1-24-18-11-7-16(13-19(18)25-2)15(8-12-20(22)23)6-3-14-4-9-17(21)10-5-14/h3-11,13H,12H2,1-2H3,(H,22,23)/b6-3+,15-8- |
| InChIKey | GDBJDUGNGJFWME-DDHXKYOOSA-N |
| XLogP | 4.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.82 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|