C21H23ClO5 — CID 88725709
carbonic acid;4-[5-(4-chlorophenyl)hexa-2,4-dien-3-yl]-1,2-dimethoxybenzene (PubChem CID 88725709) has the molecular formula C21H23ClO5 and a molecular weight of 390.86 g/mol. Its IUPAC name is carbonic acid;4-[5-(4-chlorophenyl)hexa-2,4-dien-3-yl]-1,2-dimethoxybenzene.
| Compound Name | carbonic acid;4-[5-(4-chlorophenyl)hexa-2,4-dien-3-yl]-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 88725709 |
| Molecular Formula | C21H23ClO5 |
| Molecular Weight | 390.86 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | carbonic acid;4-[5-(4-chlorophenyl)hexa-2,4-dien-3-yl]-1,2-dimethoxybenzene |
| SMILES | CC=C(C=C(C)c1ccc(Cl)cc1)c1ccc(OC)c(OC)c1.O=C(O)O |
| InChI | InChI=1S/C20H21ClO2.CH2O3/c1-5-15(12-14(2)16-6-9-18(21)10-7-16)17-8-11-19(22-3)20(13-17)23-4;2-1(3)4/h5-13H,1-4H3;(H2,2,3,4) |
| InChIKey | BMLQRIYWMRHPNI-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.86 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|