C18H19ClN4O — CID 132770474
N-[(4-chlorophenyl)methylideneamino]-4-phenylpiperazine-1-carboxamide (PubChem CID 132770474) has the molecular formula C18H19ClN4O and a molecular weight of 342.83 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methylideneamino]-4-phenylpiperazine-1-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methylideneamino]-4-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 132770474 |
| Molecular Formula | C18H19ClN4O |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[(4-chlorophenyl)methylideneamino]-4-phenylpiperazine-1-carboxamide |
| SMILES | O=C(NN=Cc1ccc(Cl)cc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H19ClN4O/c19-16-8-6-15(7-9-16)14-20-21-18(24)23-12-10-22(11-13-23)17-4-2-1-3-5-17/h1-9,14H,10-13H2,(H,21,24) |
| InChIKey | HUJKWTJKDKBWDD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|