C21H30N10O — CID 164810264
[3,5-bis[(E)-(diaminomethylhydrazinylidene)methyl]phenyl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 164810264) has the molecular formula C21H30N10O and a molecular weight of 438.54 g/mol. Its IUPAC name is [3,5-bis[(E)-(diaminomethylhydrazinylidene)methyl]phenyl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [3,5-bis[(E)-(diaminomethylhydrazinylidene)methyl]phenyl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 164810264 |
| Molecular Formula | C21H30N10O |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | [3,5-bis[(E)-(diaminomethylhydrazinylidene)methyl]phenyl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | NC(N)N/N=C/c1cc(/C=N/NC(N)N)cc(C(=O)N2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H30N10O/c22-20(23)28-26-13-15-10-16(14-27-29-21(24)25)12-17(11-15)19(32)31-8-6-30(7-9-31)18-4-2-1-3-5-18/h1-5,10-14,20-21,28-29H,6-9,22-25H2/b26-13+,27-14+ |
| InChIKey | ACDQKQHEUPAGLG-BMNRKXRESA-N |
| XLogP | -1.10 |
| TPSA | 176.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|