C25H25N5O3 — CID 143217387
amino 3-[[(E)-[4-(4-phenylpiperazin-1-yl)phenyl]methylideneamino]carbamoyl]benzoate (PubChem CID 143217387) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is amino 3-[[(E)-[4-(4-phenylpiperazin-1-yl)phenyl]methylideneamino]carbamoyl]benzoate.
| Compound Name | amino 3-[[(E)-[4-(4-phenylpiperazin-1-yl)phenyl]methylideneamino]carbamoyl]benzoate |
|---|---|
| PubChem CID | 143217387 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | amino 3-[[(E)-[4-(4-phenylpiperazin-1-yl)phenyl]methylideneamino]carbamoyl]benzoate |
| SMILES | NOC(=O)c1cccc(C(=O)N/N=C/c2ccc(N3CCN(c4ccccc4)CC3)cc2)c1 |
| InChI | InChI=1S/C25H25N5O3/c26-33-25(32)21-6-4-5-20(17-21)24(31)28-27-18-19-9-11-23(12-10-19)30-15-13-29(14-16-30)22-7-2-1-3-8-22/h1-12,17-18H,13-16,26H2,(H,28,31)/b27-18+ |
| InChIKey | NLULUWJEDUJUCL-OVVQPSECSA-N |
| XLogP | 2.81 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|