C19H27N — CID 10015927
(2E,4E)-N-butyl-3-tert-butyl-5-phenylpenta-2,4-dien-1-imine (PubChem CID 10015927) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is (2E,4E)-N-butyl-3-tert-butyl-5-phenylpenta-2,4-dien-1-imine.
| Compound Name | (2E,4E)-N-butyl-3-tert-butyl-5-phenylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 10015927 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | (2E,4E)-N-butyl-3-tert-butyl-5-phenylpenta-2,4-dien-1-imine |
| SMILES | CCCC/N=C/C=C(\C=C\c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C19H27N/c1-5-6-15-20-16-14-18(19(2,3)4)13-12-17-10-8-7-9-11-17/h7-14,16H,5-6,15H2,1-4H3/b13-12+,18-14+,20-16+ |
| InChIKey | CJQSKRGCHAWKEH-ZPOXHRAJSA-N |
| XLogP | 5.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|