C15H19Br — CID 135039609
[(1E,3E)-3-bromonona-1,3-dienyl]benzene (PubChem CID 135039609) has the molecular formula C15H19Br and a molecular weight of 279.22 g/mol. Its IUPAC name is [(1E,3E)-3-bromonona-1,3-dienyl]benzene.
| Compound Name | [(1E,3E)-3-bromonona-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 135039609 |
| Molecular Formula | C15H19Br |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | [(1E,3E)-3-bromonona-1,3-dienyl]benzene |
| SMILES | CCCCC/C=C(Br)\C=C\c1ccccc1 |
| InChI | InChI=1S/C15H19Br/c1-2-3-4-8-11-15(16)13-12-14-9-6-5-7-10-14/h5-7,9-13H,2-4,8H2,1H3/b13-12+,15-11+ |
| InChIKey | DIQWRCRFZCJFOO-GLZRVVIGSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|