C17H26OSi — CID 134982365
trimethyl-[(1E,3Z)-1-phenylocta-1,3-dien-3-yl]oxysilane (PubChem CID 134982365) has the molecular formula C17H26OSi and a molecular weight of 274.48 g/mol. Its IUPAC name is trimethyl-[(1E,3Z)-1-phenylocta-1,3-dien-3-yl]oxysilane.
| Compound Name | trimethyl-[(1E,3Z)-1-phenylocta-1,3-dien-3-yl]oxysilane |
|---|---|
| PubChem CID | 134982365 |
| Molecular Formula | C17H26OSi |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | trimethyl-[(1E,3Z)-1-phenylocta-1,3-dien-3-yl]oxysilane |
| SMILES | CCCC/C=C(/C=C/c1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C17H26OSi/c1-5-6-8-13-17(18-19(2,3)4)15-14-16-11-9-7-10-12-16/h7,9-15H,5-6,8H2,1-4H3/b15-14+,17-13- |
| InChIKey | KVHQAODOBLNDQA-NWDJVLATSA-N |
| XLogP | 5.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|