C15H22Si — CID 10036853
[(1E,3E)-2-ethyl-4-phenylbuta-1,3-dienyl]-trimethylsilane (PubChem CID 10036853) has the molecular formula C15H22Si and a molecular weight of 230.43 g/mol. Its IUPAC name is [(1E,3E)-2-ethyl-4-phenylbuta-1,3-dienyl]-trimethylsilane.
| Compound Name | [(1E,3E)-2-ethyl-4-phenylbuta-1,3-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 10036853 |
| Molecular Formula | C15H22Si |
| Molecular Weight | 230.43 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | [(1E,3E)-2-ethyl-4-phenylbuta-1,3-dienyl]-trimethylsilane |
| SMILES | CCC(/C=C/c1ccccc1)=C\[Si](C)(C)C |
| InChI | InChI=1S/C15H22Si/c1-5-14(13-16(2,3)4)11-12-15-9-7-6-8-10-15/h6-13H,5H2,1-4H3/b12-11+,14-13+ |
| InChIKey | IRCMMNHQWCFWIE-LDHFCIDVSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|