C19H30Si — CID 11437654
trimethyl-[(1E,3Z)-1-phenyldeca-1,3-dien-3-yl]silane (PubChem CID 11437654) has the molecular formula C19H30Si and a molecular weight of 286.53 g/mol. Its IUPAC name is trimethyl-[(1E,3Z)-1-phenyldeca-1,3-dien-3-yl]silane.
| Compound Name | trimethyl-[(1E,3Z)-1-phenyldeca-1,3-dien-3-yl]silane |
|---|---|
| PubChem CID | 11437654 |
| Molecular Formula | C19H30Si |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | trimethyl-[(1E,3Z)-1-phenyldeca-1,3-dien-3-yl]silane |
| SMILES | CCCCCC/C=C(/C=C/c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C19H30Si/c1-5-6-7-8-12-15-19(20(2,3)4)17-16-18-13-10-9-11-14-18/h9-11,13-17H,5-8,12H2,1-4H3/b17-16+,19-15- |
| InChIKey | HUDQKVVHJLUXSD-NPYGPQMQSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|