C16H20 — CID 177474604
[(1E,3E,5E)-5-ethylocta-1,3,5-trienyl]benzene (PubChem CID 177474604) has the molecular formula C16H20 and a molecular weight of 212.34 g/mol. Its IUPAC name is [(1E,3E,5E)-5-ethylocta-1,3,5-trienyl]benzene.
| Compound Name | [(1E,3E,5E)-5-ethylocta-1,3,5-trienyl]benzene |
|---|---|
| PubChem CID | 177474604 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | [(1E,3E,5E)-5-ethylocta-1,3,5-trienyl]benzene |
| SMILES | CC/C=C(/C=C/C=C/c1ccccc1)CC |
| InChI | InChI=1S/C16H20/c1-3-10-15(4-2)11-8-9-14-16-12-6-5-7-13-16/h5-14H,3-4H2,1-2H3/b11-8+,14-9+,15-10+ |
| InChIKey | NKBFEWPLJTWRQD-UCSOOOIQSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|