C16H20 — CID 91256649
5-ethenylocta-1,5-dienylbenzene (PubChem CID 91256649) has the molecular formula C16H20 and a molecular weight of 212.34 g/mol. Its IUPAC name is 5-ethenylocta-1,5-dienylbenzene.
| Compound Name | 5-ethenylocta-1,5-dienylbenzene |
|---|---|
| PubChem CID | 91256649 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 5-ethenylocta-1,5-dienylbenzene |
| SMILES | C=CC(=CCC)CCC=Cc1ccccc1 |
| InChI | InChI=1S/C16H20/c1-3-10-15(4-2)11-8-9-14-16-12-6-5-7-13-16/h4-7,9-10,12-14H,2-3,8,11H2,1H3 |
| InChIKey | NCSZWCNYEUUJQV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|