C16H20O — CID 71394074
5-methyl-9-phenylnona-4,8-dienal (PubChem CID 71394074) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is 5-methyl-9-phenylnona-4,8-dienal.
| Compound Name | 5-methyl-9-phenylnona-4,8-dienal |
|---|---|
| PubChem CID | 71394074 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 5-methyl-9-phenylnona-4,8-dienal |
| SMILES | CC(=CCCC=O)CCC=Cc1ccccc1 |
| InChI | InChI=1S/C16H20O/c1-15(10-7-8-14-17)9-5-6-13-16-11-3-2-4-12-16/h2-4,6,10-14H,5,7-9H2,1H3 |
| InChIKey | DIIZYACPZWGIDY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|