C18H24 — CID 10988411
[(1E)-3-butylocta-1,3,4-trienyl]benzene (PubChem CID 10988411) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is [(1E)-3-butylocta-1,3,4-trienyl]benzene.
| Compound Name | [(1E)-3-butylocta-1,3,4-trienyl]benzene |
|---|---|
| PubChem CID | 10988411 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | [(1E)-3-butylocta-1,3,4-trienyl]benzene |
| SMILES | CCCC=C=C(/C=C/c1ccccc1)CCCC |
| InChI | InChI=1S/C18H24/c1-3-5-8-12-17(11-6-4-2)15-16-18-13-9-7-10-14-18/h7-10,13-16H,3-6,11H2,1-2H3/b16-15+ |
| InChIKey | QJSKBPOZQZZXGC-FOCLMDBBSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|