C29H38 — CID 11675426
[(E)-3-(3,3-dimethyl-4-phenylbut-1-enylidene)undec-1-enyl]benzene (PubChem CID 11675426) has the molecular formula C29H38 and a molecular weight of 386.62 g/mol. Its IUPAC name is [(E)-3-(3,3-dimethyl-4-phenylbut-1-enylidene)undec-1-enyl]benzene.
| Compound Name | [(E)-3-(3,3-dimethyl-4-phenylbut-1-enylidene)undec-1-enyl]benzene |
|---|---|
| PubChem CID | 11675426 |
| Molecular Formula | C29H38 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | [(E)-3-(3,3-dimethyl-4-phenylbut-1-enylidene)undec-1-enyl]benzene |
| SMILES | CCCCCCCCC(=C=CC(C)(C)Cc1ccccc1)/C=C/c1ccccc1 |
| InChI | InChI=1S/C29H38/c1-4-5-6-7-8-11-18-27(22-21-26-16-12-9-13-17-26)23-24-29(2,3)25-28-19-14-10-15-20-28/h9-10,12-17,19-22,24H,4-8,11,18,25H2,1-3H3/b22-21+ |
| InChIKey | KSINATGKPWMACT-QURGRASLSA-N |
| XLogP | 8.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|