C29H51N — CID 139723503
2-methyl-N-(2-methylnonan-2-yl)-N-[(E)-3-phenylprop-2-enyl]nonan-2-amine (PubChem CID 139723503) has the molecular formula C29H51N and a molecular weight of 413.73 g/mol. Its IUPAC name is 2-methyl-N-(2-methylnonan-2-yl)-N-[(E)-3-phenylprop-2-enyl]nonan-2-amine.
| Compound Name | 2-methyl-N-(2-methylnonan-2-yl)-N-[(E)-3-phenylprop-2-enyl]nonan-2-amine |
|---|---|
| PubChem CID | 139723503 |
| Molecular Formula | C29H51N |
| Molecular Weight | 413.73 g/mol |
| Exact Mass | 413.40 |
| IUPAC Name | 2-methyl-N-(2-methylnonan-2-yl)-N-[(E)-3-phenylprop-2-enyl]nonan-2-amine |
| SMILES | CCCCCCCC(C)(C)N(C/C=C/c1ccccc1)C(C)(C)CCCCCCC |
| InChI | InChI=1S/C29H51N/c1-7-9-11-13-18-24-28(3,4)30(26-20-23-27-21-16-15-17-22-27)29(5,6)25-19-14-12-10-8-2/h15-17,20-23H,7-14,18-19,24-26H2,1-6H3/b23-20+ |
| InChIKey | OJBIREYPFUEUFH-BSYVCWPDSA-N |
| XLogP | 9.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.73 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|