C14H19N3O — CID 91609124
N-(N'-butylcarbamimidoyl)-3-phenylprop-2-enamide (PubChem CID 91609124) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is N-(N'-butylcarbamimidoyl)-3-phenylprop-2-enamide.
| Compound Name | N-(N'-butylcarbamimidoyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 91609124 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | N-(N'-butylcarbamimidoyl)-3-phenylprop-2-enamide |
| SMILES | CCCC/N=C(\N)NC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C14H19N3O/c1-2-3-11-16-14(15)17-13(18)10-9-12-7-5-4-6-8-12/h4-10H,2-3,11H2,1H3,(H3,15,16,17,18) |
| InChIKey | FTJPUBXDEHCPPS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|