C21H21NO — CID 134846081
(1E,4E)-N-[(E)-but-2-en-2-yl]-1,5-diphenylpenta-1,4-dien-3-imine oxide (PubChem CID 134846081) has the molecular formula C21H21NO and a molecular weight of 303.41 g/mol. Its IUPAC name is (1E,4E)-N-[(E)-but-2-en-2-yl]-1,5-diphenylpenta-1,4-dien-3-imine oxide.
| Compound Name | (1E,4E)-N-[(E)-but-2-en-2-yl]-1,5-diphenylpenta-1,4-dien-3-imine oxide |
|---|---|
| PubChem CID | 134846081 |
| Molecular Formula | C21H21NO |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (1E,4E)-N-[(E)-but-2-en-2-yl]-1,5-diphenylpenta-1,4-dien-3-imine oxide |
| SMILES | C/C=C(\C)[N+]([O-])=C(/C=C/c1ccccc1)/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H21NO/c1-3-18(2)22(23)21(16-14-19-10-6-4-7-11-19)17-15-20-12-8-5-9-13-20/h3-17H,1-2H3/b16-14+,17-15+,18-3+ |
| InChIKey | RAKJAVLDKAXIRZ-HJPBRYKHSA-N |
| XLogP | 5.29 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|